C22H20O2S2 — CID 19555061
(E)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19555061) has the molecular formula C22H20O2S2 and a molecular weight of 380.53 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19555061 |
| Molecular Formula | C22H20O2S2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (E)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(C)s2)ccc1CSc1ccccc1 |
| InChI | InChI=1S/C22H20O2S2/c1-16-8-13-22(26-16)20(23)12-10-17-9-11-18(21(14-17)24-2)15-25-19-6-4-3-5-7-19/h3-14H,15H2,1-2H3/b12-10+ |
| InChIKey | WDSZOYPBCIPLHR-ZRDIBKRKSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|