C24H20F2O3S — CID 19541052
(E)-1-[3-(difluoromethoxy)phenyl]-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]prop-2-en-1-one (PubChem CID 19541052) has the molecular formula C24H20F2O3S and a molecular weight of 426.48 g/mol. Its IUPAC name is (E)-1-[3-(difluoromethoxy)phenyl]-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19541052 |
| Molecular Formula | C24H20F2O3S |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2cccc(OC(F)F)c2)ccc1CSc1ccccc1 |
| InChI | InChI=1S/C24H20F2O3S/c1-28-23-14-17(10-12-19(23)16-30-21-8-3-2-4-9-21)11-13-22(27)18-6-5-7-20(15-18)29-24(25)26/h2-15,24H,16H2,1H3/b13-11+ |
| InChIKey | UVNOYQMIHHSCJS-ACCUITESSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|