C23H18Cl2O2S — CID 19569096
(E)-1-(3,4-dichlorophenyl)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]prop-2-en-1-one (PubChem CID 19569096) has the molecular formula C23H18Cl2O2S and a molecular weight of 429.37 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569096 |
| Molecular Formula | C23H18Cl2O2S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-3-[3-methoxy-4-(phenylsulfanylmethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(Cl)c(Cl)c2)ccc1CSc1ccccc1 |
| InChI | InChI=1S/C23H18Cl2O2S/c1-27-23-13-16(7-9-18(23)15-28-19-5-3-2-4-6-19)8-12-22(26)17-10-11-20(24)21(25)14-17/h2-14H,15H2,1H3/b12-8+ |
| InChIKey | LPXAUZGMNCOUNJ-XYOKQWHBSA-N |
| XLogP | 7.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|