C18H14Cl2O5 — CID 7973385
2-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-methoxyphenoxy]acetic acid (PubChem CID 7973385) has the molecular formula C18H14Cl2O5 and a molecular weight of 381.21 g/mol. Its IUPAC name is 2-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 7973385 |
| Molecular Formula | C18H14Cl2O5 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)ccc1OCC(=O)O |
| InChI | InChI=1S/C18H14Cl2O5/c1-24-17-9-12(4-7-16(17)25-10-18(22)23)15(21)6-3-11-2-5-13(19)14(20)8-11/h2-9H,10H2,1H3,(H,22,23)/b6-3+ |
| InChIKey | LXJNLNJBMNFLHV-ZZXKWVIFSA-N |
| XLogP | 4.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|