C21H20F2O6 — CID 9448746
2-[4-[(E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]prop-2-enoyl]-2-methoxyphenoxy]acetic acid (PubChem CID 9448746) has the molecular formula C21H20F2O6 and a molecular weight of 406.38 g/mol. Its IUPAC name is 2-[4-[(E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]prop-2-enoyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]prop-2-enoyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 9448746 |
| Molecular Formula | C21H20F2O6 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-[4-[(E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]prop-2-enoyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C(=O)/C=C/c2cc(C)c(OC(F)F)c(C)c2)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H20F2O6/c1-12-8-14(9-13(2)20(12)29-21(22)23)4-6-16(24)15-5-7-17(18(10-15)27-3)28-11-19(25)26/h4-10,21H,11H2,1-3H3,(H,25,26)/b6-4+ |
| InChIKey | KQAYCWCCWAVCOO-GQCTYLIASA-N |
| XLogP | 4.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|