C18H16F2O4 — CID 3828585
3-[4-(difluoromethoxy)phenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 3828585) has the molecular formula C18H16F2O4 and a molecular weight of 334.32 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3828585 |
| Molecular Formula | C18H16F2O4 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2ccc(OC(F)F)cc2)cc1OC |
| InChI | InChI=1S/C18H16F2O4/c1-22-16-10-6-13(11-17(16)23-2)15(21)9-5-12-3-7-14(8-4-12)24-18(19)20/h3-11,18H,1-2H3 |
| InChIKey | HHHJBFCCIJRULA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|