C22H18F2O4 — CID 7947332
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(6-methoxynaphthalen-2-yl)prop-2-en-1-one (PubChem CID 7947332) has the molecular formula C22H18F2O4 and a molecular weight of 384.38 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(6-methoxynaphthalen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(6-methoxynaphthalen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7947332 |
| Molecular Formula | C22H18F2O4 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(6-methoxynaphthalen-2-yl)prop-2-en-1-one |
| SMILES | COc1ccc2cc(C(=O)/C=C/c3ccc(OC(F)F)c(OC)c3)ccc2c1 |
| InChI | InChI=1S/C22H18F2O4/c1-26-18-8-7-15-12-17(6-5-16(15)13-18)19(25)9-3-14-4-10-20(28-22(23)24)21(11-14)27-2/h3-13,22H,1-2H3/b9-3+ |
| InChIKey | RBARDIBXBUCEOV-YCRREMRBSA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|