C19H15F2NO5 — CID 8538546
6-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]-4H-1,4-benzoxazin-3-one (PubChem CID 8538546) has the molecular formula C19H15F2NO5 and a molecular weight of 375.33 g/mol. Its IUPAC name is 6-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 8538546 |
| Molecular Formula | C19H15F2NO5 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 6-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc3c(c2)NC(=O)CO3)ccc1OC(F)F |
| InChI | InChI=1S/C19H15F2NO5/c1-25-17-8-11(3-6-16(17)27-19(20)21)2-5-14(23)12-4-7-15-13(9-12)22-18(24)10-26-15/h2-9,19H,10H2,1H3,(H,22,24)/b5-2+ |
| InChIKey | FFXVHYZVMUNGCV-GORDUTHDSA-N |
| XLogP | 3.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|