C20H17NO6 — CID 91652400
2-[2-methoxy-5-[(E)-3-(3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enoyl]phenyl]acetic acid (PubChem CID 91652400) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-[2-methoxy-5-[(E)-3-(3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enoyl]phenyl]acetic acid.
| Compound Name | 2-[2-methoxy-5-[(E)-3-(3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 91652400 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[2-methoxy-5-[(E)-3-(3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enoyl]phenyl]acetic acid |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc3c(c2)NC(=O)CO3)cc1CC(=O)O |
| InChI | InChI=1S/C20H17NO6/c1-26-17-7-4-13(9-14(17)10-20(24)25)16(22)5-2-12-3-6-18-15(8-12)21-19(23)11-27-18/h2-9H,10-11H2,1H3,(H,21,23)(H,24,25)/b5-2+ |
| InChIKey | HEOORCZZWODKAA-GORDUTHDSA-N |
| XLogP | 2.55 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|