C24H19NO4 — CID 7638145
6-[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one (PubChem CID 7638145) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 6-[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 7638145 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 6-[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(=O)/C=C/c3cccc(OCc4ccccc4)c3)cc2N1 |
| InChI | InChI=1S/C24H19NO4/c26-22(19-10-12-23-21(14-19)25-24(27)16-29-23)11-9-17-7-4-8-20(13-17)28-15-18-5-2-1-3-6-18/h1-14H,15-16H2,(H,25,27)/b11-9+ |
| InChIKey | SFKXSJOMNPCWFP-PKNBQFBNSA-N |
| XLogP | 4.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|