C22H23NO5 — CID 7638176
6-[(E)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one (PubChem CID 7638176) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 6-[(E)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(E)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 7638176 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 6-[(E)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CCCOc1c(/C=C/C(=O)c2ccc3c(c2)NC(=O)CO3)cccc1OCC |
| InChI | InChI=1S/C22H23NO5/c1-3-12-27-22-15(6-5-7-20(22)26-4-2)8-10-18(24)16-9-11-19-17(13-16)23-21(25)14-28-19/h5-11,13H,3-4,12,14H2,1-2H3,(H,23,25)/b10-8+ |
| InChIKey | VYZXFFMPNYZTJW-CSKARUKUSA-N |
| XLogP | 4.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|