C22H16O4 — CID 7947642
(E)-1-(1,3-benzodioxol-5-yl)-3-(3-phenoxyphenyl)prop-2-en-1-one (PubChem CID 7947642) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-(3-phenoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-(3-phenoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7947642 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-(3-phenoxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(Oc2ccccc2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H16O4/c23-20(17-10-12-21-22(14-17)25-15-24-21)11-9-16-5-4-8-19(13-16)26-18-6-2-1-3-7-18/h1-14H,15H2/b11-9+ |
| InChIKey | MCOYUOWYWDZIOQ-PKNBQFBNSA-N |
| XLogP | 5.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|