C19H14F4O4 — CID 19556754
(E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one (PubChem CID 19556754) has the molecular formula C19H14F4O4 and a molecular weight of 382.31 g/mol. Its IUPAC name is (E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19556754 |
| Molecular Formula | C19H14F4O4 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(OC(F)(F)C(F)F)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H14F4O4/c20-18(21)19(22,23)27-14-3-1-2-12(10-14)4-6-15(24)13-5-7-16-17(11-13)26-9-8-25-16/h1-7,10-11,18H,8-9H2/b6-4+ |
| InChIKey | SQTICCSBTBRGDT-GQCTYLIASA-N |
| XLogP | 4.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|