C16H14F4N2O2 — CID 19543542
(E)-1-(1-ethylpyrazol-4-yl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one (PubChem CID 19543542) has the molecular formula C16H14F4N2O2 and a molecular weight of 342.29 g/mol. Its IUPAC name is (E)-1-(1-ethylpyrazol-4-yl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-ethylpyrazol-4-yl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19543542 |
| Molecular Formula | C16H14F4N2O2 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (E)-1-(1-ethylpyrazol-4-yl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one |
| SMILES | CCn1cc(C(=O)/C=C/c2cccc(OC(F)(F)C(F)F)c2)cn1 |
| InChI | InChI=1S/C16H14F4N2O2/c1-2-22-10-12(9-21-22)14(23)7-6-11-4-3-5-13(8-11)24-16(19,20)15(17)18/h3-10,15H,2H2,1H3/b7-6+ |
| InChIKey | LTXXDMJFSULSAS-VOTSOKGWSA-N |
| XLogP | 4.04 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|