C23H21F3N2O3 — CID 19543466
(E)-1-(1-ethylpyrazol-4-yl)-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-en-1-one (PubChem CID 19543466) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is (E)-1-(1-ethylpyrazol-4-yl)-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-ethylpyrazol-4-yl)-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19543466 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (E)-1-(1-ethylpyrazol-4-yl)-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-en-1-one |
| SMILES | CCn1cc(C(=O)/C=C/c2ccc(OC)c(COc3cccc(C(F)(F)F)c3)c2)cn1 |
| InChI | InChI=1S/C23H21F3N2O3/c1-3-28-14-18(13-27-28)21(29)9-7-16-8-10-22(30-2)17(11-16)15-31-20-6-4-5-19(12-20)23(24,25)26/h4-14H,3,15H2,1-2H3/b9-7+ |
| InChIKey | JZPRTOYMDCANRP-VQHVLOKHSA-N |
| XLogP | 5.41 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|