C26H24N2O3 — CID 19543398
(E)-1-(1-ethylpyrazol-4-yl)-3-[4-methoxy-3-(naphthalen-2-yloxymethyl)phenyl]prop-2-en-1-one (PubChem CID 19543398) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is (E)-1-(1-ethylpyrazol-4-yl)-3-[4-methoxy-3-(naphthalen-2-yloxymethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-ethylpyrazol-4-yl)-3-[4-methoxy-3-(naphthalen-2-yloxymethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19543398 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (E)-1-(1-ethylpyrazol-4-yl)-3-[4-methoxy-3-(naphthalen-2-yloxymethyl)phenyl]prop-2-en-1-one |
| SMILES | CCn1cc(C(=O)/C=C/c2ccc(OC)c(COc3ccc4ccccc4c3)c2)cn1 |
| InChI | InChI=1S/C26H24N2O3/c1-3-28-17-23(16-27-28)25(29)12-8-19-9-13-26(30-2)22(14-19)18-31-24-11-10-20-6-4-5-7-21(20)15-24/h4-17H,3,18H2,1-2H3/b12-8+ |
| InChIKey | VUFIXWWXYURNRM-XYOKQWHBSA-N |
| XLogP | 5.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|