C25H21F3O3 — CID 19570963
(E)-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]-1-(3-methylphenyl)prop-2-en-1-one (PubChem CID 19570963) has the molecular formula C25H21F3O3 and a molecular weight of 426.43 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]-1-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]-1-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19570963 |
| Molecular Formula | C25H21F3O3 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (E)-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]-1-(3-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(C)c2)cc1COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H21F3O3/c1-17-5-3-6-19(13-17)23(29)11-9-18-10-12-24(30-2)20(14-18)16-31-22-8-4-7-21(15-22)25(26,27)28/h3-15H,16H2,1-2H3/b11-9+ |
| InChIKey | CFSZKMUQUIPUKS-PKNBQFBNSA-N |
| XLogP | 6.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|