C19H17F3O4 — CID 19562837
(E)-1-(3-hydroxyphenyl)-3-[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]prop-2-en-1-one (PubChem CID 19562837) has the molecular formula C19H17F3O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is (E)-1-(3-hydroxyphenyl)-3-[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3-hydroxyphenyl)-3-[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19562837 |
| Molecular Formula | C19H17F3O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (E)-1-(3-hydroxyphenyl)-3-[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(O)c2)cc1COCC(F)(F)F |
| InChI | InChI=1S/C19H17F3O4/c1-25-18-8-6-13(9-15(18)11-26-12-19(20,21)22)5-7-17(24)14-3-2-4-16(23)10-14/h2-10,23H,11-12H2,1H3/b7-5+ |
| InChIKey | GBTDGQLTPQVKKT-FNORWQNLSA-N |
| XLogP | 4.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|