C21H18F6O4 — CID 19542889
(E)-1-[4-(difluoromethoxy)phenyl]-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]prop-2-en-1-one (PubChem CID 19542889) has the molecular formula C21H18F6O4 and a molecular weight of 448.36 g/mol. Its IUPAC name is (E)-1-[4-(difluoromethoxy)phenyl]-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(difluoromethoxy)phenyl]-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542889 |
| Molecular Formula | C21H18F6O4 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (E)-1-[4-(difluoromethoxy)phenyl]-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC(F)F)cc2)cc1COCC(F)(F)C(F)F |
| InChI | InChI=1S/C21H18F6O4/c1-29-18-9-3-13(10-15(18)11-30-12-21(26,27)19(22)23)2-8-17(28)14-4-6-16(7-5-14)31-20(24)25/h2-10,19-20H,11-12H2,1H3/b8-2+ |
| InChIKey | LERQQHPZLMJILE-KRXBUXKQSA-N |
| XLogP | 5.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|