C21H22F4O3S — CID 19545167
(E)-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19545167) has the molecular formula C21H22F4O3S and a molecular weight of 430.46 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19545167 |
| Molecular Formula | C21H22F4O3S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (E)-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one |
| SMILES | CCCc1ccc(C(=O)/C=C/c2ccc(OC)c(COCC(F)(F)C(F)F)c2)s1 |
| InChI | InChI=1S/C21H22F4O3S/c1-3-4-16-7-10-19(29-16)17(26)8-5-14-6-9-18(27-2)15(11-14)12-28-13-21(24,25)20(22)23/h5-11,20H,3-4,12-13H2,1-2H3/b8-5+ |
| InChIKey | LDSDLBOPNZRKJA-VMPITWQZSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|