C18H17ClF4N2O3 — CID 19567364
(E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]prop-2-en-1-one (PubChem CID 19567364) has the molecular formula C18H17ClF4N2O3 and a molecular weight of 420.79 g/mol. Its IUPAC name is (E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19567364 |
| Molecular Formula | C18H17ClF4N2O3 |
| Molecular Weight | 420.79 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[4-methoxy-3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2nn(C)cc2Cl)cc1COCC(F)(F)C(F)F |
| InChI | InChI=1S/C18H17ClF4N2O3/c1-25-8-13(19)16(24-25)14(26)5-3-11-4-6-15(27-2)12(7-11)9-28-10-18(22,23)17(20)21/h3-8,17H,9-10H2,1-2H3/b5-3+ |
| InChIKey | UTQQPPGGOXRFRM-HWKANZROSA-N |
| XLogP | 4.40 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.79 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|