C15H14Cl2N2O2 — CID 19567282
(E)-3-[3-(chloromethyl)-4-methoxyphenyl]-1-(4-chloro-1-methylpyrazol-3-yl)prop-2-en-1-one (PubChem CID 19567282) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is (E)-3-[3-(chloromethyl)-4-methoxyphenyl]-1-(4-chloro-1-methylpyrazol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-(chloromethyl)-4-methoxyphenyl]-1-(4-chloro-1-methylpyrazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19567282 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (E)-3-[3-(chloromethyl)-4-methoxyphenyl]-1-(4-chloro-1-methylpyrazol-3-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2nn(C)cc2Cl)cc1CCl |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-19-9-12(17)15(18-19)13(20)5-3-10-4-6-14(21-2)11(7-10)8-16/h3-7,9H,8H2,1-2H3/b5-3+ |
| InChIKey | NAZMZKLAEJZXLS-HWKANZROSA-N |
| XLogP | 3.72 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|