C22H20ClN3O5 — CID 19567262
(E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19567262) has the molecular formula C22H20ClN3O5 and a molecular weight of 441.87 g/mol. Its IUPAC name is (E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19567262 |
| Molecular Formula | C22H20ClN3O5 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | (E)-1-(4-chloro-1-methylpyrazol-3-yl)-3-[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2nn(C)cc2Cl)cc1COc1ccc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20ClN3O5/c1-14-4-8-21(18(10-14)26(28)29)31-13-16-11-15(6-9-20(16)30-3)5-7-19(27)22-17(23)12-25(2)24-22/h4-12H,13H2,1-3H3/b7-5+ |
| InChIKey | HKPJTTUSAGFKEY-FNORWQNLSA-N |
| XLogP | 4.77 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|