C22H18N4O5 — CID 19543624
4-[[2-methoxy-5-[(E)-3-(1-methyl-4-nitropyrazol-3-yl)-3-oxoprop-1-enyl]phenyl]methoxy]benzonitrile (PubChem CID 19543624) has the molecular formula C22H18N4O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is 4-[[2-methoxy-5-[(E)-3-(1-methyl-4-nitropyrazol-3-yl)-3-oxoprop-1-enyl]phenyl]methoxy]benzonitrile.
| Compound Name | 4-[[2-methoxy-5-[(E)-3-(1-methyl-4-nitropyrazol-3-yl)-3-oxoprop-1-enyl]phenyl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 19543624 |
| Molecular Formula | C22H18N4O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-[[2-methoxy-5-[(E)-3-(1-methyl-4-nitropyrazol-3-yl)-3-oxoprop-1-enyl]phenyl]methoxy]benzonitrile |
| SMILES | COc1ccc(/C=C/C(=O)c2nn(C)cc2[N+](=O)[O-])cc1COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H18N4O5/c1-25-13-19(26(28)29)22(24-25)20(27)9-5-15-6-10-21(30-2)17(11-15)14-31-18-7-3-16(12-23)4-8-18/h3-11,13H,14H2,1-2H3/b9-5+ |
| InChIKey | GUGWQFVDTYTONE-WEVVVXLNSA-N |
| XLogP | 3.68 |
| TPSA | 120.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|