C22H21BrN2O3 — CID 19554886
(E)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-1-(1,3-dimethylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 19554886) has the molecular formula C22H21BrN2O3 and a molecular weight of 441.33 g/mol. Its IUPAC name is (E)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-1-(1,3-dimethylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-1-(1,3-dimethylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19554886 |
| Molecular Formula | C22H21BrN2O3 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (E)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-1-(1,3-dimethylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cn(C)nc2C)cc1COc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21BrN2O3/c1-15-20(13-25(2)24-15)21(26)10-4-16-5-11-22(27-3)17(12-16)14-28-19-8-6-18(23)7-9-19/h4-13H,14H2,1-3H3/b10-4+ |
| InChIKey | AHRWKAJAQHERIO-ONNFQVAWSA-N |
| XLogP | 4.97 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|