C25H25NO5S — CID 19545046
(E)-3-[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19545046) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19545046 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]-1-(5-propylthiophen-2-yl)prop-2-en-1-one |
| SMILES | CCCc1ccc(C(=O)/C=C/c2ccc(OC)c(COc3ccc(C)cc3[N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C25H25NO5S/c1-4-5-20-9-13-25(32-20)22(27)10-7-18-8-12-23(30-3)19(15-18)16-31-24-11-6-17(2)14-21(24)26(28)29/h6-15H,4-5,16H2,1-3H3/b10-7+ |
| InChIKey | ZOFNXCJXGNBCQV-JXMROGBWSA-N |
| XLogP | 6.40 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|