C23H21NO5S — CID 19557036
(E)-1-(5-ethylthiophen-2-yl)-3-[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19557036) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is (E)-1-(5-ethylthiophen-2-yl)-3-[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(5-ethylthiophen-2-yl)-3-[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19557036 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (E)-1-(5-ethylthiophen-2-yl)-3-[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | CCc1ccc(C(=O)/C=C/c2ccc(OC)c(COc3ccc([N+](=O)[O-])cc3)c2)s1 |
| InChI | InChI=1S/C23H21NO5S/c1-3-20-10-13-23(30-20)21(25)11-4-16-5-12-22(28-2)17(14-16)15-29-19-8-6-18(7-9-19)24(26)27/h4-14H,3,15H2,1-2H3/b11-4+ |
| InChIKey | KOJYHMIVKXSLEM-NYYWCZLTSA-N |
| XLogP | 5.70 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|