C25H26O3S — CID 19555109
(E)-3-[4-methoxy-3-[(4-propan-2-ylphenoxy)methyl]phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19555109) has the molecular formula C25H26O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(4-propan-2-ylphenoxy)methyl]phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(4-propan-2-ylphenoxy)methyl]phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19555109 |
| Molecular Formula | C25H26O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(4-propan-2-ylphenoxy)methyl]phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(C)s2)cc1COc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C25H26O3S/c1-17(2)20-8-10-22(11-9-20)28-16-21-15-19(7-13-24(21)27-4)6-12-23(26)25-14-5-18(3)29-25/h5-15,17H,16H2,1-4H3/b12-6+ |
| InChIKey | GHCVOAGUTFHBJB-WUXMJOGZSA-N |
| XLogP | 6.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|