C16H16O3S — CID 9213036
(E)-3-(3,4-dimethoxyphenyl)-1-(5-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 9213036) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-(5-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9213036 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(C)s2)cc1OC |
| InChI | InChI=1S/C16H16O3S/c1-11-4-9-16(20-11)13(17)7-5-12-6-8-14(18-2)15(10-12)19-3/h4-10H,1-3H3/b7-5+ |
| InChIKey | NVHREDMOHAKXDF-FNORWQNLSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|