C22H18F2O3S — CID 19555042
(E)-3-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19555042) has the molecular formula C22H18F2O3S and a molecular weight of 400.45 g/mol. Its IUPAC name is (E)-3-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19555042 |
| Molecular Formula | C22H18F2O3S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (E)-3-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(C)s2)cc1COc1ccc(F)cc1F |
| InChI | InChI=1S/C22H18F2O3S/c1-14-3-10-22(28-14)19(25)7-4-15-5-8-20(26-2)16(11-15)13-27-21-9-6-17(23)12-18(21)24/h3-12H,13H2,1-2H3/b7-4+ |
| InChIKey | AYDIGWBRFPLGAM-QPJJXVBHSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|