C21H26NO3+ — CID 8829895
diethyl-[[5-[(E)-3-(3-hydroxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methyl]azanium (PubChem CID 8829895) has the molecular formula C21H26NO3+ and a molecular weight of 340.44 g/mol. Its IUPAC name is diethyl-[[5-[(E)-3-(3-hydroxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methyl]azanium.
| Compound Name | diethyl-[[5-[(E)-3-(3-hydroxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methyl]azanium |
|---|---|
| PubChem CID | 8829895 |
| Molecular Formula | C21H26NO3+ |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | diethyl-[[5-[(E)-3-(3-hydroxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1cc(C(=O)/C=C/c2cccc(O)c2)ccc1OC |
| InChI | InChI=1S/C21H25NO3/c1-4-22(5-2)15-18-14-17(10-12-21(18)25-3)20(24)11-9-16-7-6-8-19(23)13-16/h6-14,23H,4-5,15H2,1-3H3/p+1/b11-9+ |
| InChIKey | FKYZKOJMPYGHKL-PKNBQFBNSA-O |
| XLogP | 2.72 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|