C19H17BrO4S — CID 18271783
2-[[5-[(E)-3-(3-bromophenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid (PubChem CID 18271783) has the molecular formula C19H17BrO4S and a molecular weight of 421.31 g/mol. Its IUPAC name is 2-[[5-[(E)-3-(3-bromophenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[5-[(E)-3-(3-bromophenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 18271783 |
| Molecular Formula | C19H17BrO4S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | 2-[[5-[(E)-3-(3-bromophenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid |
| SMILES | COc1ccc(C(=O)/C=C/c2cccc(Br)c2)cc1CSCC(=O)O |
| InChI | InChI=1S/C19H17BrO4S/c1-24-18-8-6-14(10-15(18)11-25-12-19(22)23)17(21)7-5-13-3-2-4-16(20)9-13/h2-10H,11-12H2,1H3,(H,22,23)/b7-5+ |
| InChIKey | MMWXRGCMDJEIIM-FNORWQNLSA-N |
| XLogP | 4.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|