C20H19O5S- — CID 7504593
2-[[2-methoxy-5-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetate (PubChem CID 7504593) has the molecular formula C20H19O5S- and a molecular weight of 371.43 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetate.
| Compound Name | 2-[[2-methoxy-5-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 7504593 |
| Molecular Formula | C20H19O5S- |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-[[2-methoxy-5-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetate |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC)c(CSCC(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H20O5S/c1-24-17-7-3-14(4-8-17)5-9-18(21)15-6-10-19(25-2)16(11-15)12-26-13-20(22)23/h3-11H,12-13H2,1-2H3,(H,22,23)/p-1/b9-5+ |
| InChIKey | WGNNQPPRSCCUCX-WEVVVXLNSA-M |
| XLogP | 2.58 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|