C17H15O4S2- — CID 7598200
2-[[2-methoxy-5-[(E)-3-thiophen-3-ylprop-2-enoyl]phenyl]methylsulfanyl]acetate (PubChem CID 7598200) has the molecular formula C17H15O4S2- and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(E)-3-thiophen-3-ylprop-2-enoyl]phenyl]methylsulfanyl]acetate.
| Compound Name | 2-[[2-methoxy-5-[(E)-3-thiophen-3-ylprop-2-enoyl]phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 7598200 |
| Molecular Formula | C17H15O4S2- |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-[[2-methoxy-5-[(E)-3-thiophen-3-ylprop-2-enoyl]phenyl]methylsulfanyl]acetate |
| SMILES | COc1ccc(C(=O)/C=C/c2ccsc2)cc1CSCC(=O)[O-] |
| InChI | InChI=1S/C17H16O4S2/c1-21-16-5-3-13(8-14(16)10-23-11-17(19)20)15(18)4-2-12-6-7-22-9-12/h2-9H,10-11H2,1H3,(H,19,20)/p-1/b4-2+ |
| InChIKey | RFSZPOHXHDOWMW-DUXPYHPUSA-M |
| XLogP | 2.64 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|