C20H16F3O4S- — CID 9037384
2-[[2-methoxy-5-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]phenyl]methylsulfanyl]acetate (PubChem CID 9037384) has the molecular formula C20H16F3O4S- and a molecular weight of 409.41 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]phenyl]methylsulfanyl]acetate.
| Compound Name | 2-[[2-methoxy-5-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 9037384 |
| Molecular Formula | C20H16F3O4S- |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-[[2-methoxy-5-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]phenyl]methylsulfanyl]acetate |
| SMILES | COc1ccc(C(=O)/C=C/c2ccccc2C(F)(F)F)cc1CSCC(=O)[O-] |
| InChI | InChI=1S/C20H17F3O4S/c1-27-18-9-7-14(10-15(18)11-28-12-19(25)26)17(24)8-6-13-4-2-3-5-16(13)20(21,22)23/h2-10H,11-12H2,1H3,(H,25,26)/p-1/b8-6+ |
| InChIKey | XYXRQEIKNJHIPN-SOFGYWHQSA-M |
| XLogP | 3.59 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|