C18H17O4S2- — CID 9037408
2-[[2-methoxy-5-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]phenyl]methylsulfanyl]acetate (PubChem CID 9037408) has the molecular formula C18H17O4S2- and a molecular weight of 361.46 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]phenyl]methylsulfanyl]acetate.
| Compound Name | 2-[[2-methoxy-5-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 9037408 |
| Molecular Formula | C18H17O4S2- |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-[[2-methoxy-5-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]phenyl]methylsulfanyl]acetate |
| SMILES | COc1ccc(C(=O)/C=C/c2sccc2C)cc1CSCC(=O)[O-] |
| InChI | InChI=1S/C18H18O4S2/c1-12-7-8-24-17(12)6-4-15(19)13-3-5-16(22-2)14(9-13)10-23-11-18(20)21/h3-9H,10-11H2,1-2H3,(H,20,21)/p-1/b6-4+ |
| InChIKey | ITBGDKXLFPNCIH-GQCTYLIASA-M |
| XLogP | 2.94 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|