C20H20O6S — CID 7598215
2-[[5-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid (PubChem CID 7598215) has the molecular formula C20H20O6S and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-[[5-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[5-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 7598215 |
| Molecular Formula | C20H20O6S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-[[5-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]-2-methoxyphenyl]methylsulfanyl]acetic acid |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC)c(CSCC(=O)O)c2)cc1O |
| InChI | InChI=1S/C20H20O6S/c1-25-18-8-5-14(10-15(18)11-27-12-20(23)24)16(21)6-3-13-4-7-19(26-2)17(22)9-13/h3-10,22H,11-12H2,1-2H3,(H,23,24)/b6-3+ |
| InChIKey | VQDBEYIAYUJFGP-ZZXKWVIFSA-N |
| XLogP | 3.62 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|