C22H22O5S — CID 16560821
2-[[2-methoxy-5-[(E)-3-(4-prop-2-enoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetic acid (PubChem CID 16560821) has the molecular formula C22H22O5S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(E)-3-(4-prop-2-enoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[2-methoxy-5-[(E)-3-(4-prop-2-enoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 16560821 |
| Molecular Formula | C22H22O5S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[[2-methoxy-5-[(E)-3-(4-prop-2-enoxyphenyl)prop-2-enoyl]phenyl]methylsulfanyl]acetic acid |
| SMILES | C=CCOc1ccc(/C=C/C(=O)c2ccc(OC)c(CSCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H22O5S/c1-3-12-27-19-8-4-16(5-9-19)6-10-20(23)17-7-11-21(26-2)18(13-17)14-28-15-22(24)25/h3-11,13H,1,12,14-15H2,2H3,(H,24,25)/b10-6+ |
| InChIKey | KLUZOTRESMOKDF-UXBLZVDNSA-N |
| XLogP | 4.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|