C21H22O5 — CID 59084049
(E)-1-(4-prop-2-enoxyphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 59084049) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is (E)-1-(4-prop-2-enoxyphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-prop-2-enoxyphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59084049 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (E)-1-(4-prop-2-enoxyphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCOc1ccc(C(=O)/C=C/c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C21H22O5/c1-5-12-26-17-9-6-15(7-10-17)18(22)11-8-16-13-20(24-3)21(25-4)14-19(16)23-2/h5-11,13-14H,1,12H2,2-4H3/b11-8+ |
| InChIKey | JAOVCOLSWGHHLE-DHZHZOJOSA-N |
| XLogP | 4.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|