C29H38O4 — CID 54038781
3-[2,4-bis[(2-methylpropan-2-yl)oxy]-5-propylphenyl]-1-(4-prop-2-enoxyphenyl)prop-2-en-1-one (PubChem CID 54038781) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 3-[2,4-bis[(2-methylpropan-2-yl)oxy]-5-propylphenyl]-1-(4-prop-2-enoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[2,4-bis[(2-methylpropan-2-yl)oxy]-5-propylphenyl]-1-(4-prop-2-enoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54038781 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 3-[2,4-bis[(2-methylpropan-2-yl)oxy]-5-propylphenyl]-1-(4-prop-2-enoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCOc1ccc(C(=O)C=Cc2cc(CCC)c(OC(C)(C)C)cc2OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H38O4/c1-9-11-22-19-23(27(33-29(6,7)8)20-26(22)32-28(3,4)5)14-17-25(30)21-12-15-24(16-13-21)31-18-10-2/h10,12-17,19-20H,2,9,11,18H2,1,3-8H3 |
| InChIKey | LKVSPARTIOSJNW-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|