C27H37NO3 — CID 18179043
(E)-3-[2,4-bis[(2-methylpropan-2-yl)oxy]-5-propylphenyl]-1-[4-(methylamino)phenyl]prop-2-en-1-one (PubChem CID 18179043) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is (E)-3-[2,4-bis[(2-methylpropan-2-yl)oxy]-5-propylphenyl]-1-[4-(methylamino)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[2,4-bis[(2-methylpropan-2-yl)oxy]-5-propylphenyl]-1-[4-(methylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18179043 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (E)-3-[2,4-bis[(2-methylpropan-2-yl)oxy]-5-propylphenyl]-1-[4-(methylamino)phenyl]prop-2-en-1-one |
| SMILES | CCCc1cc(/C=C/C(=O)c2ccc(NC)cc2)c(OC(C)(C)C)cc1OC(C)(C)C |
| InChI | InChI=1S/C27H37NO3/c1-9-10-20-17-21(13-16-23(29)19-11-14-22(28-8)15-12-19)25(31-27(5,6)7)18-24(20)30-26(2,3)4/h11-18,28H,9-10H2,1-8H3/b16-13+ |
| InChIKey | YZUTUCQFMJWFPN-DTQAZKPQSA-N |
| XLogP | 6.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|