C27H35NO3 — CID 18179082
(E)-1-[4-(methylamino)phenyl]-3-[5-(2-methylbut-3-en-2-yl)-2,4-di(propan-2-yloxy)phenyl]prop-2-en-1-one (PubChem CID 18179082) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is (E)-1-[4-(methylamino)phenyl]-3-[5-(2-methylbut-3-en-2-yl)-2,4-di(propan-2-yloxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(methylamino)phenyl]-3-[5-(2-methylbut-3-en-2-yl)-2,4-di(propan-2-yloxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18179082 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (E)-1-[4-(methylamino)phenyl]-3-[5-(2-methylbut-3-en-2-yl)-2,4-di(propan-2-yloxy)phenyl]prop-2-en-1-one |
| SMILES | C=CC(C)(C)c1cc(/C=C/C(=O)c2ccc(NC)cc2)c(OC(C)C)cc1OC(C)C |
| InChI | InChI=1S/C27H35NO3/c1-9-27(6,7)23-16-21(25(30-18(2)3)17-26(23)31-19(4)5)12-15-24(29)20-10-13-22(28-8)14-11-20/h9-19,28H,1H2,2-8H3/b15-12+ |
| InChIKey | LPYUBTSAGLBUHF-NTCAYCPXSA-N |
| XLogP | 6.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|