C25H32O4 — CID 18178322
(E)-3-[5-tert-butyl-2,4-di(propan-2-yloxy)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 18178322) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is (E)-3-[5-tert-butyl-2,4-di(propan-2-yloxy)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-tert-butyl-2,4-di(propan-2-yloxy)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18178322 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (E)-3-[5-tert-butyl-2,4-di(propan-2-yloxy)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CC(C)Oc1cc(OC(C)C)c(C(C)(C)C)cc1/C=C/C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H32O4/c1-16(2)28-23-15-24(29-17(3)4)21(25(5,6)7)14-19(23)10-13-22(27)18-8-11-20(26)12-9-18/h8-17,26H,1-7H3/b13-10+ |
| InChIKey | PLLGQQKBZNSVFX-JLHYYAGUSA-N |
| XLogP | 6.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|