C30H41NO4 — CID 18178099
4-[(E)-3-[5-tert-butyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoyl]-N,N-dimethylbenzamide (PubChem CID 18178099) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is 4-[(E)-3-[5-tert-butyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(E)-3-[5-tert-butyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 18178099 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | 4-[(E)-3-[5-tert-butyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(C(=O)/C=C/c2cc(C(C)(C)C)c(OC(C)(C)C)cc2OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H41NO4/c1-28(2,3)23-18-22(25(34-29(4,5)6)19-26(23)35-30(7,8)9)16-17-24(32)20-12-14-21(15-13-20)27(33)31(10)11/h12-19H,1-11H3/b17-16+ |
| InChIKey | PWGLTFQOUQOSHH-WUKNDPDISA-N |
| XLogP | 6.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|