C28H37NO3 — CID 54078864
1-(4-aminophenyl)-3-[5-(2-methylbut-3-en-2-yl)-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one (PubChem CID 54078864) has the molecular formula C28H37NO3 and a molecular weight of 435.61 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[5-(2-methylbut-3-en-2-yl)-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one.
| Compound Name | 1-(4-aminophenyl)-3-[5-(2-methylbut-3-en-2-yl)-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 54078864 |
| Molecular Formula | C28H37NO3 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 1-(4-aminophenyl)-3-[5-(2-methylbut-3-en-2-yl)-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one |
| SMILES | C=CC(C)(C)c1cc(C=CC(=O)c2ccc(N)cc2)c(OC(C)(C)C)cc1OC(C)(C)C |
| InChI | InChI=1S/C28H37NO3/c1-10-28(8,9)22-17-20(13-16-23(30)19-11-14-21(29)15-12-19)24(31-26(2,3)4)18-25(22)32-27(5,6)7/h10-18H,1,29H2,2-9H3 |
| InChIKey | MLQSVDPWEAAEFT-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|