C26H32O4 — CID 18178853
(E)-1-(4-hydroxyphenyl)-3-[5-(2-methylbut-3-en-2-yl)-2,4-di(propan-2-yloxy)phenyl]prop-2-en-1-one (PubChem CID 18178853) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is (E)-1-(4-hydroxyphenyl)-3-[5-(2-methylbut-3-en-2-yl)-2,4-di(propan-2-yloxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-hydroxyphenyl)-3-[5-(2-methylbut-3-en-2-yl)-2,4-di(propan-2-yloxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18178853 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (E)-1-(4-hydroxyphenyl)-3-[5-(2-methylbut-3-en-2-yl)-2,4-di(propan-2-yloxy)phenyl]prop-2-en-1-one |
| SMILES | C=CC(C)(C)c1cc(/C=C/C(=O)c2ccc(O)cc2)c(OC(C)C)cc1OC(C)C |
| InChI | InChI=1S/C26H32O4/c1-8-26(6,7)22-15-20(11-14-23(28)19-9-12-21(27)13-10-19)24(29-17(2)3)16-25(22)30-18(4)5/h8-18,27H,1H2,2-7H3/b14-11+ |
| InChIKey | JUDRHYGIMIQJNU-SDNWHVSQSA-N |
| XLogP | 6.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|