C34H44O7 — CID 173244553
[4-[3-[4-(2,2-dimethylpropanoyloxy)-3-methoxy-5-(2-methylbut-3-en-2-yl)-2-propan-2-yloxyphenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 173244553) has the molecular formula C34H44O7 and a molecular weight of 564.72 g/mol. Its IUPAC name is [4-[3-[4-(2,2-dimethylpropanoyloxy)-3-methoxy-5-(2-methylbut-3-en-2-yl)-2-propan-2-yloxyphenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[3-[4-(2,2-dimethylpropanoyloxy)-3-methoxy-5-(2-methylbut-3-en-2-yl)-2-propan-2-yloxyphenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 173244553 |
| Molecular Formula | C34H44O7 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | [4-[3-[4-(2,2-dimethylpropanoyloxy)-3-methoxy-5-(2-methylbut-3-en-2-yl)-2-propan-2-yloxyphenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=CC(C)(C)c1cc(C=CC(=O)c2ccc(OC(=O)C(C)(C)C)cc2)c(OC(C)C)c(OC)c1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C34H44O7/c1-13-34(10,11)25-20-23(27(39-21(2)3)29(38-12)28(25)41-31(37)33(7,8)9)16-19-26(35)22-14-17-24(18-15-22)40-30(36)32(4,5)6/h13-21H,1H2,2-12H3 |
| InChIKey | SVHZXGHRPOSPAZ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|