C36H50O6 — CID 18179045
[4-[(E)-3-[3,5-ditert-butyl-2-(2,2-dimethylpropanoyloxy)-6-propan-2-yloxyphenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 18179045) has the molecular formula C36H50O6 and a molecular weight of 578.79 g/mol. Its IUPAC name is [4-[(E)-3-[3,5-ditert-butyl-2-(2,2-dimethylpropanoyloxy)-6-propan-2-yloxyphenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(E)-3-[3,5-ditert-butyl-2-(2,2-dimethylpropanoyloxy)-6-propan-2-yloxyphenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 18179045 |
| Molecular Formula | C36H50O6 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | [4-[(E)-3-[3,5-ditert-butyl-2-(2,2-dimethylpropanoyloxy)-6-propan-2-yloxyphenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)Oc1c(C(C)(C)C)cc(C(C)(C)C)c(OC(=O)C(C)(C)C)c1/C=C/C(=O)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C36H50O6/c1-22(2)40-29-25(19-20-28(37)23-15-17-24(18-16-23)41-31(38)35(9,10)11)30(42-32(39)36(12,13)14)27(34(6,7)8)21-26(29)33(3,4)5/h15-22H,1-14H3/b20-19+ |
| InChIKey | FEEMNRIIBWHQMB-FMQUCBEESA-N |
| XLogP | 8.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|