C35H48O7 — CID 54385119
[4-[3-[3,5-ditert-butyl-2-(2,2-dimethylpropanoyloxy)-6-methoxyphenyl]-2-methoxyprop-2-enoyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 54385119) has the molecular formula C35H48O7 and a molecular weight of 580.76 g/mol. Its IUPAC name is [4-[3-[3,5-ditert-butyl-2-(2,2-dimethylpropanoyloxy)-6-methoxyphenyl]-2-methoxyprop-2-enoyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[3-[3,5-ditert-butyl-2-(2,2-dimethylpropanoyloxy)-6-methoxyphenyl]-2-methoxyprop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54385119 |
| Molecular Formula | C35H48O7 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | [4-[3-[3,5-ditert-butyl-2-(2,2-dimethylpropanoyloxy)-6-methoxyphenyl]-2-methoxyprop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | COC(=Cc1c(OC)c(C(C)(C)C)cc(C(C)(C)C)c1OC(=O)C(C)(C)C)C(=O)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H48O7/c1-32(2,3)24-20-25(33(4,5)6)29(42-31(38)35(10,11)12)23(28(24)40-14)19-26(39-13)27(36)21-15-17-22(18-16-21)41-30(37)34(7,8)9/h15-20H,1-14H3 |
| InChIKey | VCRMYNXYKHUEKV-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|