C32H42O7 — CID 54548255
[4-[3-[5-tert-butyl-4-(2,2-dimethylpropanoyloxy)-2-ethoxyphenyl]-2-methoxyprop-2-enoyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 54548255) has the molecular formula C32H42O7 and a molecular weight of 538.68 g/mol. Its IUPAC name is [4-[3-[5-tert-butyl-4-(2,2-dimethylpropanoyloxy)-2-ethoxyphenyl]-2-methoxyprop-2-enoyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[3-[5-tert-butyl-4-(2,2-dimethylpropanoyloxy)-2-ethoxyphenyl]-2-methoxyprop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54548255 |
| Molecular Formula | C32H42O7 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | [4-[3-[5-tert-butyl-4-(2,2-dimethylpropanoyloxy)-2-ethoxyphenyl]-2-methoxyprop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CCOc1cc(OC(=O)C(C)(C)C)c(C(C)(C)C)cc1C=C(OC)C(=O)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H42O7/c1-12-37-24-19-25(39-29(35)32(8,9)10)23(30(2,3)4)17-21(24)18-26(36-11)27(33)20-13-15-22(16-14-20)38-28(34)31(5,6)7/h13-19H,12H2,1-11H3 |
| InChIKey | ZICDPHACIGAKRE-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|